Products 216699-86-4
CAS 216699-86-4 appears in our catalog under these names: 2-Chloro-6,7-dimethoxyquinoxaline 98%, 2-Chloro-6,7-dimethoxyquinoxaline, 98%, 98%, 2-Chloro-6,7-dimethoxyquinoxaline, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
2-chloro-6,7-dimethoxyquinoxaline (CAS 216699-86-4) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 2-chloro-6,7-dimethoxyquinoxaline. InChIKey: KJGOYBHXJBMXIL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 2-chloro-6,7-dimethoxyquinoxaline |
| InChIKey | KJGOYBHXJBMXIL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CC(=N2)Cl)OC |
Computed by PubChem (NCBI)