Products 2167478-26-2

CAS 2167478-26-2 is the registry number for 3,4-Diamino-5-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3,4-diamino-5-methoxybenzoic acid (CAS 2167478-26-2) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 3,4-diamino-5-methoxybenzoic acid. InChIKey: CBBTXJAFDBTOKD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O3
Molecular weight182.18 g/mol
IUPAC name3,4-diamino-5-methoxybenzoic acid
InChIKeyCBBTXJAFDBTOKD-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1N)N)C(=O)O

Computed by PubChem (NCBI)