CAS 2167478-26-2 is the registry number for 3,4-Diamino-5-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,4-diamino-5-methoxybenzoic acid (CAS 2167478-26-2) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 3,4-diamino-5-methoxybenzoic acid. InChIKey: CBBTXJAFDBTOKD-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 3,4-diamino-5-methoxybenzoic acid |
| InChIKey | CBBTXJAFDBTOKD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1N)N)C(=O)O |
Computed by PubChem (NCBI)