Products 2167516-48-3
CAS 2167516-48-3 is the registry number for 2-{1-((tert-Butoxy)carbonyl)-4,4-dimethylpyrrolidin-2-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetic acid (CAS 2167516-48-3) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 2-[4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetic acid. InChIKey: UGWKMLJXJULVJU-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 2-[4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetic acid |
| InChIKey | UGWKMLJXJULVJU-UHFFFAOYSA-N |
| SMILES | CC1(CC(N(C1)C(=O)OC(C)(C)C)CC(=O)O)C |
Computed by PubChem (NCBI)