Products 2167911-76-2
CAS 2167911-76-2 is the registry number for 3-Amino-2-methyl-6-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-amino-2-methyl-6-nitrobenzoic acid (CAS 2167911-76-2) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 3-amino-2-methyl-6-nitrobenzoic acid. InChIKey: XIPPLQPZJNZAKE-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 3-amino-2-methyl-6-nitrobenzoic acid |
| InChIKey | XIPPLQPZJNZAKE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)O)[N+](=O)[O-])N |
Computed by PubChem (NCBI)
Synonyms:
3-Amino-2-methyl-6-nitrobenzoic acid