Products 2167921-85-7
CAS 2167921-85-7 is the registry number for 1-Bromo-3-ethyl-5-(trifluoromethoxy)benzene, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-3-ethyl-5-(trifluoromethoxy)benzene (CAS 2167921-85-7) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 1-bromo-3-ethyl-5-(trifluoromethoxy)benzene. InChIKey: UKUCLPFIAKVUIR-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 1-bromo-3-ethyl-5-(trifluoromethoxy)benzene |
| InChIKey | UKUCLPFIAKVUIR-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC(=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)