Products 2168875-92-9
CAS 2168875-92-9 appears in our catalog under these names: 2，2–difluoro–1–(3–methoxyphenyl)cyclopropane–1–carboxylic acid, 2，2-difluoro-1-(3-methoxyphenyl)cyclopropane-1-carboxylic acid, 2,2-difluoro-1-(3-methoxyphenyl)cyclopropane-1-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 5g.
2,2-difluoro-1-(3-methoxyphenyl)cyclopropane-1-carboxylic acid (CAS 2168875-92-9) is a chemical compound with the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. IUPAC name: 2,2-difluoro-1-(3-methoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: FRDWGFASPVTIDY-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O3 |
|---|---|
| Molecular weight | 228.19 g/mol |
| IUPAC name | 2,2-difluoro-1-(3-methoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | FRDWGFASPVTIDY-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2(CC2(F)F)C(=O)O |
Computed by PubChem (NCBI)