Products 2169945-18-8

CAS 2169945-18-8 is the registry number for 9-Methoxy-3-oxo-3H-benzo[f]chromene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

9-methoxy-3-oxobenzo[f]chromene-2-carboxylic acid (CAS 2169945-18-8) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 9-methoxy-3-oxobenzo[f]chromene-2-carboxylic acid. InChIKey: RSKBYUMTHYEJOU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10O5
Molecular weight270.24 g/mol
IUPAC name9-methoxy-3-oxobenzo[f]chromene-2-carboxylic acid
InChIKeyRSKBYUMTHYEJOU-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C=CC3=C2C=C(C(=O)O3)C(=O)O

Computed by PubChem (NCBI)