Products 2172559-92-9
CAS 2172559-92-9 is the registry number for Methyl 2-(5-acetylpyridin-2-yl)propanoate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg.
Methyl 2-(5-acetyl-2-pyridinyl)propanoate (CAS 2172559-92-9) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: methyl 2-(5-acetyl-2-pyridinyl)propanoate. InChIKey: DSJWUFMOQUFMAR-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | methyl 2-(5-acetyl-2-pyridinyl)propanoate |
| InChIKey | DSJWUFMOQUFMAR-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=C(C=C1)C(=O)C)C(=O)OC |
Computed by PubChem (NCBI)