CAS 2172569-39-8 is the registry number for 1-(Pyrazin-2-yl)-2,3-dihydro-1H-pyrazol-3-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-pyrazin-2-yl-1H-pyrazol-5-one;hydrochloride (CAS 2172569-39-8) is a chemical compound with the molecular formula C7H7ClN4O and a molecular weight of 198.61 g/mol. IUPAC name: 2-pyrazin-2-yl-1H-pyrazol-5-one;hydrochloride. InChIKey: SMCZPXRSTZXWGA-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4O |
|---|---|
| Molecular weight | 198.61 g/mol |
| IUPAC name | 2-pyrazin-2-yl-1H-pyrazol-5-one;hydrochloride |
| InChIKey | SMCZPXRSTZXWGA-UHFFFAOYSA-N |
| SMILES | C1=CN(NC1=O)C2=NC=CN=C2.Cl |
Computed by PubChem (NCBI)