CAS 2172879-84-2 is the registry number for EGFR-IN-160. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(furan-2-yl)-4-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one (CAS 2172879-84-2) is a chemical compound with the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. IUPAC name: 6-(furan-2-yl)-4-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one. InChIKey: AZXGVYYXWSGGHS-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O4 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 6-(furan-2-yl)-4-(4-hydroxy-3-methoxyphenyl)-1H-pyrimidin-2-one |
| InChIKey | AZXGVYYXWSGGHS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=NC(=O)NC(=C2)C3=CC=CO3)O |
Computed by PubChem (NCBI)