Products 2174-16-5

CAS 2174-16-5 is the registry number for Trolamine salicylate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxybenzoic acid (CAS 2174-16-5) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: 2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxybenzoic acid. InChIKey: UEVAMYPIMMOEFW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21NO6
Molecular weight287.31 g/mol
IUPAC name2-[bis(2-hydroxyethyl)amino]ethanol;2-hydroxybenzoic acid
InChIKeyUEVAMYPIMMOEFW-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)O.C(CO)N(CCO)CCO

Computed by PubChem (NCBI)