Products 21741-98-0
CAS 21741-98-0 appears in our catalog under these names: 4-(4-Chlorophenyl)-1,2,5-oxadiazol-3-amine, 4-(4-Chlorophenyl)-1,2,5-oxadiazol-3-amine 97%, 4-(4-Chlorophenyl)-1,2,5-oxadiazol-3-amine, 97%, 97%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g.
4-(4-chlorophenyl)-1,2,5-oxadiazol-3-amine (CAS 21741-98-0) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 4-(4-chlorophenyl)-1,2,5-oxadiazol-3-amine. InChIKey: NLEBVIVMWGDDRK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1,2,5-oxadiazol-3-amine |
| InChIKey | NLEBVIVMWGDDRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NON=C2N)Cl |
Computed by PubChem (NCBI)