CAS 2185-92-4 appears in our catalog under these names: 2–Aminobiphenyl Hydrochloride, 2-Aminobiphenyl Hydrochloride 97%, 2-Aminobiphenyl Hydrochloride, 97%, 97%, 2-Aminobiphenyl Hydrochloride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100g.
2-phenylaniline;hydrochloride (CAS 2185-92-4) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 2-phenylaniline;hydrochloride. InChIKey: QHYYXPLERUSFAV-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 2-phenylaniline;hydrochloride |
| InChIKey | QHYYXPLERUSFAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2N.Cl |
Computed by PubChem (NCBI)