CAS 21875-91-2 appears in our catalog under these names: 5,8-Dimethyl-3,4-dihydro-2h-1-benzopyran-4-one, 95%, 5,8-Dimethyl-3,4-dihydro-2H-1-benzopyran-4-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
5,8-dimethyl-2,3-dihydrochromen-4-one (CAS 21875-91-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 5,8-dimethyl-2,3-dihydrochromen-4-one. InChIKey: NGHNVBFCBFQAEY-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 5,8-dimethyl-2,3-dihydrochromen-4-one |
| InChIKey | NGHNVBFCBFQAEY-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=O)CCOC2=C(C=C1)C |
Computed by PubChem (NCBI)