CAS 21900-36-7 appears in our catalog under these names: 3-(tert-Butyl)benzoyl chloride, 97%, 3-tert-Butylbenzoyl chloride, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
3-tert-butylbenzoyl chloride (CAS 21900-36-7) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 3-tert-butylbenzoyl chloride. InChIKey: GYLMOVQXUVCWLK-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 3-tert-butylbenzoyl chloride |
| InChIKey | GYLMOVQXUVCWLK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC(=C1)C(=O)Cl |
Computed by PubChem (NCBI)