Products 21911-75-1
CAS 21911-75-1 appears in our catalog under these names: 2–(Methyl(phenyl)amino)acetic acid hydrochloride, 2-(Methyl(phenyl)amino)acetic acid hydrochloride, 2-(Methyl(phenyl)amino)acetic acid hydrochloride, 97%, 97%, 2-(Methyl(phenyl)amino)acetic acid hydrochloride, 98%, N-Ph-N-Me-Gly-OH HCl, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg, 25g.
2-(N-methylanilino)acetic acid;hydrochloride (CAS 21911-75-1) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 2-(N-methylanilino)acetic acid;hydrochloride. InChIKey: GYPHSVJFSAGJNQ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 2-(N-methylanilino)acetic acid;hydrochloride |
| InChIKey | GYPHSVJFSAGJNQ-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(Methyl(phenyl)amino)acetic acid hydrochloride, 2-[methyl(phenyl)amino]acetic acid hydrochloride, N-METHYL-N-PHENYLGLYCINE HYDROCHLORIDE, 2-(N-methylanilino)acetic acid;hydrochloride, 2-(N-methylanilino)acetic acid hydrochloride, 2-(Methyl(phenyl)amino)aceticacidhydrochloride, 2-[methyl(phenyl)amino]ethanoic acid hydrochloride, N-Methyl-N-phenylglycine HCl, N-Methyl-N-phenylglycine--hydrogen chloride (1/1)