Products 2193064-81-0
CAS 2193064-81-0 appears in our catalog under these names: Methyl 2-hydroxy-6-methylpyridine-3-carboxylate hydrochloride, 95%, Methyl 2-hydroxy-6-methylnicotinate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
Methyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate;hydrochloride (CAS 2193064-81-0) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: methyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate;hydrochloride. InChIKey: TUUIRXYYXJDYFA-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | methyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate;hydrochloride |
| InChIKey | TUUIRXYYXJDYFA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C(=O)N1)C(=O)OC.Cl |
Computed by PubChem (NCBI)