CAS 499157-23-2 appears in our catalog under these names: Methyl 4-amino-3-hydroxybenzoate hydrochloride, 95%, Methyl 4-amino-3-hydroxybenzoate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Methyl 4-amino-3-hydroxybenzoate;hydrochloride (CAS 499157-23-2) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: methyl 4-amino-3-hydroxybenzoate;hydrochloride. InChIKey: UVNWERBBTPQNME-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | methyl 4-amino-3-hydroxybenzoate;hydrochloride |
| InChIKey | UVNWERBBTPQNME-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)N)O.Cl |
Computed by PubChem (NCBI)