Products 943635-10-7

CAS 943635-10-7 appears in our catalog under these names: 6-Methoxy-4-methylpyridine-3-carboxylic acid hydrochloride, 95%, 6-Methoxy-4-methylnicotinic acid hydrochloride, 97%, 6-Methoxy-4-methylpyridine-3-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

6-methoxy-4-methylpyridine-3-carboxylic acid;hydrochloride (CAS 943635-10-7) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: 6-methoxy-4-methylpyridine-3-carboxylic acid;hydrochloride. InChIKey: LMEQBOXUEMCZJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO3
Molecular weight203.62 g/mol
IUPAC name6-methoxy-4-methylpyridine-3-carboxylic acid;hydrochloride
InChIKeyLMEQBOXUEMCZJJ-UHFFFAOYSA-N
SMILESCC1=CC(=NC=C1C(=O)O)OC.Cl

Computed by PubChem (NCBI)