CAS 68701-23-5 appears in our catalog under these names: 2-Amino-3-methoxybenzoic acid hydrochloride, 95%, 2-amino-3-methoxybenzoic acid hydrochloride, 98%, 3-Methoxyanthranilic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
2-amino-3-methoxybenzoic acid;hydrochloride (CAS 68701-23-5) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: 2-amino-3-methoxybenzoic acid;hydrochloride. InChIKey: KFRMVPFWAQRSNW-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | 2-amino-3-methoxybenzoic acid;hydrochloride |
| InChIKey | KFRMVPFWAQRSNW-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1N)C(=O)O.Cl |
Computed by PubChem (NCBI)