CAS 86214-14-4 appears in our catalog under these names: Methyl 2-amino-3-hydroxybenzoate hydrochloride, 95%, Methyl 2-amino-3-hydroxybenzoate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 100g.
Methyl 2-amino-3-hydroxybenzoate;hydrochloride (CAS 86214-14-4) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: methyl 2-amino-3-hydroxybenzoate;hydrochloride. InChIKey: YBWKUDNIEGRUJR-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | methyl 2-amino-3-hydroxybenzoate;hydrochloride |
| InChIKey | YBWKUDNIEGRUJR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)