CAS 857200-24-9 appears in our catalog under these names: 5-Amino-2-methoxybenzoic acid hydrochloride, 98%, 5-Amino-2-methoxybenzoic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g.
5-amino-2-methoxybenzoic acid;hydrochloride (CAS 857200-24-9) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: 5-amino-2-methoxybenzoic acid;hydrochloride. InChIKey: GCYAIWNHFZLICM-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | 5-amino-2-methoxybenzoic acid;hydrochloride |
| InChIKey | GCYAIWNHFZLICM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)