CAS 2193106-55-5 appears in our catalog under these names: Dopamine–d5 hydrochloride, Dopamine-d5 (hydrochloride), 99.6%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 1 mg, 5 mg, 10 mg.
4-(2-amino-1,1-dideuterioethyl)-3,5,6-trideuteriobenzene-1,2-diol;hydrochloride (CAS 2193106-55-5) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 194.67 g/mol. IUPAC name: 4-(2-amino-1,1-dideuterioethyl)-3,5,6-trideuteriobenzene-1,2-diol;hydrochloride. InChIKey: CTENFNNZBMHDDG-UVZAMVGFSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 194.67 g/mol |
| IUPAC name | 4-(2-amino-1,1-dideuterioethyl)-3,5,6-trideuteriobenzene-1,2-diol;hydrochloride |
| InChIKey | CTENFNNZBMHDDG-UVZAMVGFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])CN)[2H])O)O)[2H].Cl |
Computed by PubChem (NCBI)