CAS 27160-01-6 appears in our catalog under these names: Dopamine-D2 Hydrochloride, >95% (HPLC), 2-(3,4-Dihydroxyphenyl)ethyl-2,2-d2-amine HCl, 98 atom % D, min 98% Chemical Purity, Dopamine-d2 (hydrochloride), 99.6%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 5mg, 0,1g, 0,05g, 1 mg.
4-(2-amino-1,1-dideuterioethyl)benzene-1,2-diol;hydrochloride (CAS 27160-01-6) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: 4-(2-amino-1,1-dideuterioethyl)benzene-1,2-diol;hydrochloride. InChIKey: CTENFNNZBMHDDG-BCKZTNHCSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 4-(2-amino-1,1-dideuterioethyl)benzene-1,2-diol;hydrochloride |
| InChIKey | CTENFNNZBMHDDG-BCKZTNHCSA-N |
| SMILES | [2H]C([2H])(CN)C1=CC(=C(C=C1)O)O.Cl |
Computed by PubChem (NCBI)