Products 335080-94-9
CAS 335080-94-9 appears in our catalog under these names: 2-(3,4-Dihydroxyphenyl-13C6)ethylamine HCl, 99 atom % 13C, min 98% Chemical Purity, Dopamine–13C6 hydrochloride, DOPAMINE-13C6 HCL, 2-(3,4-DIHYDROXYPHENYL-13C6)ETHYLAMINE HCL, 98%, 98%, Dopamine-13C6 (hydrochloride), 98.71%. Offered by: CDN, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 0,01g, 1mg, 5mg, 1ML, 5 mg, 1 mg.
4-(2-aminoethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,2-diol;hydrochloride (CAS 335080-94-9) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 195.59 g/mol. IUPAC name: 4-(2-aminoethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,2-diol;hydrochloride. InChIKey: CTENFNNZBMHDDG-HHULZBBASA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 195.59 g/mol |
| IUPAC name | 4-(2-aminoethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,2-diol;hydrochloride |
| InChIKey | CTENFNNZBMHDDG-HHULZBBASA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1CCN)O)O.Cl |
Computed by PubChem (NCBI)