Products 53587-30-7
CAS 53587-30-7 appears in our catalog under these names: Dopamine-d3 HCl, Dopamine-d3 Hydrochloride, >95% (HPLC), 2-(3,4-Dihydroxyphenyl-d3)ethylamine HCl, 98 atom % D, min 98% Chemical Purity, Dopamine–d3 hydrochloride, Dopamine-d3 (hydrochloride), 99.88%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 1,5mg, 15mg, 3mg, 0,1g, 0,05g, 1mg, 10mg.
4-(2-aminoethyl)-3,5,6-trideuteriobenzene-1,2-diol;hydrochloride (CAS 53587-30-7) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 192.66 g/mol. IUPAC name: 4-(2-aminoethyl)-3,5,6-trideuteriobenzene-1,2-diol;hydrochloride. InChIKey: CTENFNNZBMHDDG-GONYBWEFSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 192.66 g/mol |
| IUPAC name | 4-(2-aminoethyl)-3,5,6-trideuteriobenzene-1,2-diol;hydrochloride |
| InChIKey | CTENFNNZBMHDDG-GONYBWEFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCN)[2H])O)O)[2H].Cl |
Computed by PubChem (NCBI)