Products 369656-74-6
CAS 369656-74-6 appears in our catalog under these names: 2-(3,4-Dihydroxyphenyl)ethyl-1-13C-amine-15N HCl, 99 atom % 13C, 99 atom % 15N, min 98% Chemical Purity, Dopamine-13C,15N (hydrochloride), 99.02%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 1 mg, 10 mg, 5 mg.
4-(2-(15N)azanyl(213C)ethyl)benzene-1,2-diol;hydrochloride (CAS 369656-74-6) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 191.62 g/mol. IUPAC name: 4-(2-(15N)azanyl(213C)ethyl)benzene-1,2-diol;hydrochloride. InChIKey: CTENFNNZBMHDDG-FACGKWEASA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 191.62 g/mol |
| IUPAC name | 4-(2-(15N)azanyl(213C)ethyl)benzene-1,2-diol;hydrochloride |
| InChIKey | CTENFNNZBMHDDG-FACGKWEASA-N |
| SMILES | C1=CC(=C(C=C1C[13CH2][15NH2])O)O.Cl |
Computed by PubChem (NCBI)