CAS 2197052-94-9 appears in our catalog under these names: Cyclopropyl(4-fluorophenyl)methanamine hydrochloride, 98%, Cyclopropyl(4-fluorophenyl)methanamine hydrochloride, Cyclopropyl(4-fluorophenyl)methanamine hydrochloride, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 250mg, 2,5g, 100mg, 1g, 5g.
Cyclopropyl-(4-fluorophenyl)methanamine;hydrochloride (CAS 2197052-94-9) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: cyclopropyl-(4-fluorophenyl)methanamine;hydrochloride. InChIKey: JEDQGNZWUCZQQJ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | cyclopropyl-(4-fluorophenyl)methanamine;hydrochloride |
| InChIKey | JEDQGNZWUCZQQJ-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)