CAS 219712-63-7 is the registry number for Methyl 2-chloro-5-nitrophenylacetate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 2-(2-chloro-5-nitrophenyl)acetate (CAS 219712-63-7) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: methyl 2-(2-chloro-5-nitrophenyl)acetate. InChIKey: NMTXRGYKJNMEFK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | methyl 2-(2-chloro-5-nitrophenyl)acetate |
| InChIKey | NMTXRGYKJNMEFK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)