CAS 219722-12-0 is the registry number for 4,7,8-Trimethylcoumarin, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
4,7,8-trimethylchromen-2-one (CAS 219722-12-0) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 4,7,8-trimethylchromen-2-one. InChIKey: SQUBBLKWEKHJLJ-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 4,7,8-trimethylchromen-2-one |
| InChIKey | SQUBBLKWEKHJLJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=O)O2)C)C |
Computed by PubChem (NCBI)