Products 21977-42-4

CAS 21977-42-4 is the registry number for 3-(10H-Phenoxazin-10-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-phenoxazin-10-ylpropanoic acid (CAS 21977-42-4) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 3-phenoxazin-10-ylpropanoic acid. InChIKey: AWOWBVDJKXFKFV-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13NO3
Molecular weight255.27 g/mol
IUPAC name3-phenoxazin-10-ylpropanoic acid
InChIKeyAWOWBVDJKXFKFV-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)N(C3=CC=CC=C3O2)CCC(=O)O

Computed by PubChem (NCBI)