CAS 2199280-76-5 is the registry number for Rel-(2R,3S)-3-fluoropyrrolidine-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(2S,3R)-3-fluoropyrrolidine-2-carboxylic acid (CAS 2199280-76-5) is a chemical compound with the molecular formula C5H8FNO2 and a molecular weight of 133.12 g/mol. IUPAC name: (2S,3R)-3-fluoropyrrolidine-2-carboxylic acid. InChIKey: WLGLSRHRSYWDST-QWWZWVQMSA-N.
| Molecular formula | C5H8FNO2 |
|---|---|
| Molecular weight | 133.12 g/mol |
| IUPAC name | (2S,3R)-3-fluoropyrrolidine-2-carboxylic acid |
| InChIKey | WLGLSRHRSYWDST-QWWZWVQMSA-N |
| SMILES | C1CN[C@H]([C@@H]1F)C(=O)O |
Computed by PubChem (NCBI)