CAS 261350-69-0 is the registry number for (2R,3R)–3–Fluoropyrrolidine–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1g.
(2R,3R)-3-fluoropyrrolidine-2-carboxylic acid (CAS 261350-69-0) is a chemical compound with the molecular formula C5H8FNO2 and a molecular weight of 133.12 g/mol. IUPAC name: (2R,3R)-3-fluoropyrrolidine-2-carboxylic acid. InChIKey: WLGLSRHRSYWDST-DMTCNVIQSA-N.
| Molecular formula | C5H8FNO2 |
|---|---|
| Molecular weight | 133.12 g/mol |
| IUPAC name | (2R,3R)-3-fluoropyrrolidine-2-carboxylic acid |
| InChIKey | WLGLSRHRSYWDST-DMTCNVIQSA-N |
| SMILES | C1CN[C@@H]([C@@H]1F)C(=O)O |
Computed by PubChem (NCBI)