Products 220000-86-2
CAS 220000-86-2 appears in our catalog under these names: tert–Butyl 4–chloropicolinate, tert-Butyl 4-chloropicolinate 98%, tert-Butyl 4-chloropicolinate, 98%, 98%, tert-Butyl 4-chloropicolinate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
Tert-butyl 4-chloropyridine-2-carboxylate (CAS 220000-86-2) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: tert-butyl 4-chloropyridine-2-carboxylate. InChIKey: BSCMJQUASNXFIA-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | tert-butyl 4-chloropyridine-2-carboxylate |
| InChIKey | BSCMJQUASNXFIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC=CC(=C1)Cl |
Computed by PubChem (NCBI)