CAS 220389-14-0 is the registry number for Ethyl 2-chloro-4-cyanobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 2-chloro-4-cyanobenzoate (CAS 220389-14-0) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: ethyl 2-chloro-4-cyanobenzoate. InChIKey: DJTWNJRPXUAKTR-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | ethyl 2-chloro-4-cyanobenzoate |
| InChIKey | DJTWNJRPXUAKTR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)C#N)Cl |
Computed by PubChem (NCBI)