Products 220504-75-6
CAS 220504-75-6 appears in our catalog under these names: 2,4-Dimethyl-5-nitrobenzoic acid, 97%, 2,4–Dimethyl–5–nitrobenzoic acid, 2,4-Dimethyl-5-nitrobenzoic acid, 2,4-Dimethyl-5-nitrobenzoic acid 98%, 2，4-Dimethyl-5-nitrobenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 50g, 250mg.
2,4-dimethyl-5-nitrobenzoic acid (CAS 220504-75-6) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2,4-dimethyl-5-nitrobenzoic acid. InChIKey: OVWSQNZKIRGLMK-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2,4-dimethyl-5-nitrobenzoic acid |
| InChIKey | OVWSQNZKIRGLMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])C |
Computed by PubChem (NCBI)
Synonyms:
2,4-Dimethyl-5-nitrobenzoic acid, OVWSQNZKIRGLMK-UHFFFAOYSA-N, Benzoic acid, 2,4-dimethyl-5-nitro- (9CI), 2,4-dimethyl-5-nitro-benzoic acid, 5-nitro-2,4-dimethylbenzoic acid, Oprea1_244078, 2,4-Dimethyl-5-nitrobenzoicacid, 2,4-dimethyl-5-nitro benzoicacid, 2,4-dimeth, 24-Dimethyl-5-nitrobenzoic acid