Products 851775-73-0
CAS 851775-73-0 is the registry number for Dexketoprofen Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.
Propan-2-yl (2S)-2-(3-benzoylphenyl)propanoate (CAS 851775-73-0) is a chemical compound with the molecular formula C19H20O3 and a molecular weight of 296.4 g/mol. IUPAC name: propan-2-yl (2S)-2-(3-benzoylphenyl)propanoate. InChIKey: IXHQKBLIJOIESQ-AWEZNQCLSA-N.
| Molecular formula | C19H20O3 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | propan-2-yl (2S)-2-(3-benzoylphenyl)propanoate |
| InChIKey | IXHQKBLIJOIESQ-AWEZNQCLSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)OC(C)C |
Computed by PubChem (NCBI)
Synonyms:
Dexketoprofen Isopropyl Ester