Products 22121-58-0
CAS 22121-58-0 appears in our catalog under these names: 2-[(2,6-Dichlorophenyl)amino]benzaldehyde, 95%, Diclofenac EP Impurity B, 2-((2,6-Dichlorophenyl)amino)benzaldehyde (Diclofenac impurity), >95% (HPLC), Diclofenac Impurity B, Diclofenac Sodium EP Impurity B. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, Mikromol. Available pack sizes: 100mg, on request, 10mg, 25mg, 5mg, 50mg, 500mg, 250mg.
2-(2,6-dichloroanilino)benzaldehyde (CAS 22121-58-0) is a chemical compound with the molecular formula C13H9Cl2NO and a molecular weight of 266.12 g/mol. IUPAC name: 2-(2,6-dichloroanilino)benzaldehyde. InChIKey: MILOIOYXRHLAAH-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | 2-(2,6-dichloroanilino)benzaldehyde |
| InChIKey | MILOIOYXRHLAAH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-((2,6-Dichlorophenyl)amino)benzaldehyde, Diclofenac impurity B, 2-(2,6-Dichloroanilino)benzaldehyde, o-(2,6-Dichloroanilino)benzaldehyde, Anthranilaldehyde, N-(2,6-dichlorophenyl)-, Diclofenac sodium impurity B [EP], Benzaldehyde, 2-((2,6-dichlorophenyl)amino)-, Diclofenac potassium impurity B [EP], Diclofenac sodium specified impurity B [EP], Diclofenac potassium specified impurity B [EP]