Products 54979-73-6
CAS 54979-73-6 is the registry number for 3-Chloro-n-(4-chlorophenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N-(4-chlorophenyl)benzamide (CAS 54979-73-6) is a chemical compound with the molecular formula C13H9Cl2NO and a molecular weight of 266.12 g/mol. IUPAC name: 3-chloro-N-(4-chlorophenyl)benzamide. InChIKey: SVOJTVKPDNERKX-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | 3-chloro-N-(4-chlorophenyl)benzamide |
| InChIKey | SVOJTVKPDNERKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)