CAS 2958-36-3 appears in our catalog under these names: Lorazepam EP Impurity A, 2-Amino-2’,5-dichlorobenzophenone, >95% (HPLC), (2-Amino-5-chlorophenyl)(2-chlorophenyl)methanone (2-Amino-2',5-dichlorobenzophenone), 2-Amino-2',5-dichlorobenzophenone, 2–Amino–2',5–dichlorobenzophenone. Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, GLPBio. Available pack sizes: on request, 2,5g, 25mg, 10mg, 100g, 50g, 1g, 5g.
(2-amino-5-chlorophenyl)-(2-chlorophenyl)methanone (CAS 2958-36-3) is a chemical compound with the molecular formula C13H9Cl2NO and a molecular weight of 266.12 g/mol. IUPAC name: (2-amino-5-chlorophenyl)-(2-chlorophenyl)methanone. InChIKey: KWZYIAJRFJVQDO-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)-(2-chlorophenyl)methanone |
| InChIKey | KWZYIAJRFJVQDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Cl)N)Cl |
Computed by PubChem (NCBI)