CAS 2670-39-5 is the registry number for 2-Chloro-N-(2-chlorophenyl)benzamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-(2-chlorophenyl)benzamide (CAS 2670-39-5) is a chemical compound with the molecular formula C13H9Cl2NO and a molecular weight of 266.12 g/mol. IUPAC name: 2-chloro-N-(2-chlorophenyl)benzamide. InChIKey: NIQANWYLZAOWCD-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | 2-chloro-N-(2-chlorophenyl)benzamide |
| InChIKey | NIQANWYLZAOWCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)