CAS 5625-08-1 is the registry number for (2-Amino-5-chlorophenyl)(3-chlorophenyl)methanone. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
(2-amino-5-chlorophenyl)-(3-chlorophenyl)methanone (CAS 5625-08-1) is a chemical compound with the molecular formula C13H9Cl2NO and a molecular weight of 266.12 g/mol. IUPAC name: (2-amino-5-chlorophenyl)-(3-chlorophenyl)methanone. InChIKey: IEGJLMOKNJZBTH-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)-(3-chlorophenyl)methanone |
| InChIKey | IEGJLMOKNJZBTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)C2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)