Products 22126-97-2
CAS 22126-97-2 is the registry number for 2-Aminomethyl-3-phenyl-3 H -quinazolin-4-one Hcl. Offered by: Fluorochem. Available pack sizes: 1g.
2-(aminomethyl)-3-phenylquinazolin-4-one (CAS 22126-97-2) is a chemical compound with the molecular formula C15H13N3O and a molecular weight of 251.28 g/mol. IUPAC name: 2-(aminomethyl)-3-phenylquinazolin-4-one. InChIKey: CZRPKCIAWIDQLI-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-(aminomethyl)-3-phenylquinazolin-4-one |
| InChIKey | CZRPKCIAWIDQLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NC3=CC=CC=C3C2=O)CN |
Computed by PubChem (NCBI)