CAS 221311-16-6 appears in our catalog under these names: 6-Bromo-2-methyl-2h-benzo[b][1,4]oxazin-3(4h)-one, 97%, 6-Bromo-2-methyl-2H-1,4-benzoxazin-3(4H)-one, 6-Bromo-2-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 95%, 95%, 6-BROMO-2-METHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 1g, 5g, 10g, 100mg, 250mg, 500mg.
6-bromo-2-methyl-4H-1,4-benzoxazin-3-one (CAS 221311-16-6) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one. InChIKey: NUXLDNTZFXDNBA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-2-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | NUXLDNTZFXDNBA-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(O1)C=CC(=C2)Br |
Computed by PubChem (NCBI)