CAS 22138-72-3 appears in our catalog under these names: (E)-3-(4-Fluorophenyl)-2-methylacrylic acid, 97%, 3-(4-Fluorophenyl)-2-methylacrylic acid, 95% (E), 95% (E). Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-(4-fluorophenyl)-2-methylprop-2-enoic acid (CAS 22138-72-3) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: (E)-3-(4-fluorophenyl)-2-methylprop-2-enoic acid. InChIKey: AQQMERSMRLTKCK-VOTSOKGWSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | (E)-3-(4-fluorophenyl)-2-methylprop-2-enoic acid |
| InChIKey | AQQMERSMRLTKCK-VOTSOKGWSA-N |
| SMILES | C/C(=C\C1=CC=C(C=C1)F)/C(=O)O |
Computed by PubChem (NCBI)