CAS 2216-24-2 is the registry number for (4-Nitrophenyl)propiolic Acid. Offered by: TRC. Available pack sizes: 1g, 500mg.
3-(4-nitrophenyl)prop-2-ynoic acid (CAS 2216-24-2) is a chemical compound with the molecular formula C9H5NO4 and a molecular weight of 191.14 g/mol. IUPAC name: 3-(4-nitrophenyl)prop-2-ynoic acid. InChIKey: SMMZCQTZVBTDLS-UHFFFAOYSA-N.
| Molecular formula | C9H5NO4 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 3-(4-nitrophenyl)prop-2-ynoic acid |
| InChIKey | SMMZCQTZVBTDLS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)