CAS 2216746-87-9 appears in our catalog under these names: Sacubitril Impurity 45, 4-((3R,5S)-5-((1,1'-Biphenyl)-4-ylmethyl)-3-methyl-2-oxopyrrolidin-1-yl)-4-oxobutanoic Acid, >95% (HPLC), Sacubitril Impurity 19. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg.
4-[(3R,5S)-3-methyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidin-1-yl]-4-oxobutanoic acid (CAS 2216746-87-9) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 4-[(3R,5S)-3-methyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidin-1-yl]-4-oxobutanoic acid. InChIKey: VWCKXAQRSUUVFU-BEFAXECRSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4-[(3R,5S)-3-methyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidin-1-yl]-4-oxobutanoic acid |
| InChIKey | VWCKXAQRSUUVFU-BEFAXECRSA-N |
| SMILES | C[C@@H]1C[C@H](N(C1=O)C(=O)CCC(=O)O)CC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)