Products 2459446-54-7
CAS 2459446-54-7 appears in our catalog under these names: Sacubitril Impurity 19, SACUBITRIL LACTAM. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 25MG.
4-[(3R,5S)-3-methyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidin-1-yl]-4-oxobutanoic acid (CAS 2459446-54-7) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 4-[(3R,5S)-3-methyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidin-1-yl]-4-oxobutanoic acid. InChIKey: VWCKXAQRSUUVFU-BEFAXECRSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4-[(3R,5S)-3-methyl-2-oxo-5-[(4-phenylphenyl)methyl]pyrrolidin-1-yl]-4-oxobutanoic acid |
| InChIKey | VWCKXAQRSUUVFU-BEFAXECRSA-N |
| SMILES | C[C@@H]1C[C@H](N(C1=O)C(=O)CCC(=O)O)CC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Sacubitril Impurity G, Sacubitril Impurity N38