Products 2219375-71-8

CAS 2219375-71-8 is the registry number for Methyl 3-amino-4-chloro-5-methylbenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-amino-4-chloro-5-methylbenzoate;hydrochloride (CAS 2219375-71-8) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: methyl 3-amino-4-chloro-5-methylbenzoate;hydrochloride. InChIKey: YAHKJDWOIVHXEO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11Cl2NO2
Molecular weight236.09 g/mol
IUPAC namemethyl 3-amino-4-chloro-5-methylbenzoate;hydrochloride
InChIKeyYAHKJDWOIVHXEO-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1Cl)N)C(=O)OC.Cl

Computed by PubChem (NCBI)