Products 2222512-00-5
CAS 2222512-00-5 is the registry number for 5-Bromo-2-(methoxy-d3)benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-bromo-2-(trideuteriomethoxy)benzoic acid (CAS 2222512-00-5) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 234.06 g/mol. IUPAC name: 5-bromo-2-(trideuteriomethoxy)benzoic acid. InChIKey: JFDUXZIRWBYBAQ-FIBGUPNXSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 234.06 g/mol |
| IUPAC name | 5-bromo-2-(trideuteriomethoxy)benzoic acid |
| InChIKey | JFDUXZIRWBYBAQ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)